About [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate
[1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate (PubChem CID 53392924) has the molecular formula C31H23F3O5S
and a molecular weight of 564.58 g/mol. Its IUPAC name is [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 53392924 |
| Molecular Formula | C31H23F3O5S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
| SMILES | CCc1ccc(-c2cc(OS(=O)(=O)C(F)(F)F)c(-c3ccc(CC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C31H23F3O5S/c1-3-18-9-13-20(14-10-18)24-17-25(39-40(37,38)31(32,33)34)26(21-15-11-19(4-2)12-16-21)28-27(24)29(35)22-7-5-6-8-23(22)30(28)36/h5-17H,3-4H2,1-2H3 |
| InChIKey | OZLNXETWEBYKPY-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate (CID 53392924) is [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate is CCc1ccc(-c2cc(OS(=O)(=O)C(F)(F)F)c(-c3ccc(CC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate?
The InChIKey is OZLNXETWEBYKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H23F3O5S/c1-3-18-9-13-20(14-10-18)24-17-25(39-40(37,38)31(32,33)34)26(21-15-11-19(4-2)12-16-21)28-27(24)29(35)22-7-5-6-8-23(22)30(28)36/h5-17H,3-4H2,1-2H3.
What are the key properties of [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate?
[1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate has a molecular weight of 564.58 g/mol, XLogP of 7.15, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-bis(4-ethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 53392924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).