C31H23F3O5S — CID 53392925
[1,4-bis(3,5-dimethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate (PubChem CID 53392925) has the molecular formula C31H23F3O5S and a molecular weight of 564.58 g/mol. Its IUPAC name is [1,4-bis(3,5-dimethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1,4-bis(3,5-dimethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 53392925 |
| Molecular Formula | C31H23F3O5S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.12 |
| IUPAC Name | [1,4-bis(3,5-dimethylphenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C)cc(-c2cc(OS(=O)(=O)C(F)(F)F)c(-c3cc(C)cc(C)c3)c3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C31H23F3O5S/c1-16-9-17(2)12-20(11-16)24-15-25(39-40(37,38)31(32,33)34)26(21-13-18(3)10-19(4)14-21)28-27(24)29(35)22-7-5-6-8-23(22)30(28)36/h5-15H,1-4H3 |
| InChIKey | DNQKTQMYESLCBO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|