C15H19Cl2N — CID 53392939
(3aR,7aS)-7a-(2,4-dichlorophenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole (PubChem CID 53392939) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is (3aR,7aS)-7a-(2,4-dichlorophenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole.
| Compound Name | (3aR,7aS)-7a-(2,4-dichlorophenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 53392939 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (3aR,7aS)-7a-(2,4-dichlorophenyl)-2-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
| SMILES | CN1C[C@@H]2CCCC[C@]2(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2N/c1-18-9-11-4-2-3-7-15(11,10-18)13-6-5-12(16)8-14(13)17/h5-6,8,11H,2-4,7,9-10H2,1H3/t11-,15-/m0/s1 |
| InChIKey | FCMFWPCHZOKPLR-NHYWBVRUSA-N |
| XLogP | 4.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |