About [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate
[4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate (PubChem CID 53393045) has the molecular formula C28H18N4O2
and a molecular weight of 442.48 g/mol. Its IUPAC name is [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate.
Molecular Properties
| Compound Name | [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate |
| PubChem CID | 53393045 |
| Molecular Formula | C28H18N4O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2ccn3c(-c4ccnc5ccccc45)nnc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H18N4O2/c33-28(20-6-2-1-3-7-20)34-22-12-10-19(11-13-22)21-15-17-32-26(18-21)30-31-27(32)24-14-16-29-25-9-5-4-8-23(24)25/h1-18H |
| InChIKey | LZJBVVYOVZJQEW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate?
The IUPAC name of [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate (CID 53393045) is [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate.
What is the SMILES notation for [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate?
The canonical SMILES for [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate is O=C(Oc1ccc(-c2ccn3c(-c4ccnc5ccccc45)nnc3c2)cc1)c1ccccc1.
What is the InChIKey of [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate?
The InChIKey is LZJBVVYOVZJQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H18N4O2/c33-28(20-6-2-1-3-7-20)34-22-12-10-19(11-13-22)21-15-17-32-26(18-21)30-31-27(32)24-14-16-29-25-9-5-4-8-23(24)25/h1-18H.
What are the key properties of [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate?
[4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate has a molecular weight of 442.48 g/mol, XLogP of 5.83, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-quinolin-4-yl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)phenyl] benzoate is sourced from PubChem (CID 53393045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).