About (5S,6R)-5,6-diphenylpiperazin-2-one
(5S,6R)-5,6-diphenylpiperazin-2-one (PubChem CID 53393309) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is (5S,6R)-5,6-diphenylpiperazin-2-one.
Molecular Properties
| Compound Name | (5S,6R)-5,6-diphenylpiperazin-2-one |
| PubChem CID | 53393309 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (5S,6R)-5,6-diphenylpiperazin-2-one |
| SMILES | O=C1CN[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C16H16N2O/c19-14-11-17-15(12-7-3-1-4-8-12)16(18-14)13-9-5-2-6-10-13/h1-10,15-17H,11H2,(H,18,19)/t15-,16+/m0/s1 |
| InChIKey | OXNZYVLTFNKTNK-JKSUJKDBSA-N |
| XLogP | 2.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S,6R)-5,6-diphenylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-5,6-diphenylpiperazin-2-one?
The IUPAC name of (5S,6R)-5,6-diphenylpiperazin-2-one (CID 53393309) is (5S,6R)-5,6-diphenylpiperazin-2-one.
What is the SMILES notation for (5S,6R)-5,6-diphenylpiperazin-2-one?
The canonical SMILES for (5S,6R)-5,6-diphenylpiperazin-2-one is O=C1CN[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1.
What is the InChIKey of (5S,6R)-5,6-diphenylpiperazin-2-one?
The InChIKey is OXNZYVLTFNKTNK-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H16N2O/c19-14-11-17-15(12-7-3-1-4-8-12)16(18-14)13-9-5-2-6-10-13/h1-10,15-17H,11H2,(H,18,19)/t15-,16+/m0/s1.
What are the key properties of (5S,6R)-5,6-diphenylpiperazin-2-one?
(5S,6R)-5,6-diphenylpiperazin-2-one has a molecular weight of 252.32 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5,6-diphenylpiperazin-2-one is sourced from PubChem (CID 53393309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).