About 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine
4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine (PubChem CID 53393411) has the molecular formula C5HCl2N3O
and a molecular weight of 189.99 g/mol. Its IUPAC name is 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine |
| PubChem CID | 53393411 |
| Molecular Formula | C5HCl2N3O |
| Molecular Weight | 189.99 g/mol |
| Exact Mass | 188.95 |
| IUPAC Name | 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine |
| SMILES | Clc1nc(Cl)c2cnoc2n1 |
| InChI | InChI=1S/C5HCl2N3O/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H |
| InChIKey | CVFZEUAWGRBDRV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.99 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine?
The IUPAC name of 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine (CID 53393411) is 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine?
The canonical SMILES for 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine is Clc1nc(Cl)c2cnoc2n1.
What is the InChIKey of 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine?
The InChIKey is CVFZEUAWGRBDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HCl2N3O/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H.
What are the key properties of 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine?
4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine has a molecular weight of 189.99 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-[1,2]oxazolo[5,4-d]pyrimidine is sourced from PubChem (CID 53393411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).