C19H18ClNO2 — CID 5339345
4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-1-methyl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one (PubChem CID 5339345) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-1-methyl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one.
| Compound Name | 4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-1-methyl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 5339345 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-[(E)-3-(2-chlorophenyl)prop-2-enoyl]-1-methyl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one |
| SMILES | Cc1[nH]c(=O)c(C(=O)/C=C/c2ccccc2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C19H18ClNO2/c1-12-14-7-3-4-8-15(14)18(19(23)21-12)17(22)11-10-13-6-2-5-9-16(13)20/h2,5-6,9-11H,3-4,7-8H2,1H3,(H,21,23)/b11-10+ |
| InChIKey | KGJQQJAVAAIPBN-ZHACJKMWSA-N |
| XLogP | 4.11 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|