About 4-methylazepan-4-ol
4-methylazepan-4-ol (PubChem CID 53393484) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 4-methylazepan-4-ol.
Molecular Properties
| Compound Name | 4-methylazepan-4-ol |
| PubChem CID | 53393484 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 4-methylazepan-4-ol |
| SMILES | CC1(O)CCCNCC1 |
| InChI | InChI=1S/C7H15NO/c1-7(9)3-2-5-8-6-4-7/h8-9H,2-6H2,1H3 |
| InChIKey | NUSFCKJOSCESDP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylazepan-4-ol?
The IUPAC name of 4-methylazepan-4-ol (CID 53393484) is 4-methylazepan-4-ol.
What is the SMILES notation for 4-methylazepan-4-ol?
The canonical SMILES for 4-methylazepan-4-ol is CC1(O)CCCNCC1.
What is the InChIKey of 4-methylazepan-4-ol?
The InChIKey is NUSFCKJOSCESDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-7(9)3-2-5-8-6-4-7/h8-9H,2-6H2,1H3.
What are the key properties of 4-methylazepan-4-ol?
4-methylazepan-4-ol has a molecular weight of 129.20 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylazepan-4-ol is sourced from PubChem (CID 53393484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).