C9H9F7N2O2 — CID 533937
N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 533937) has the molecular formula C9H9F7N2O2 and a molecular weight of 310.17 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 533937 |
| Molecular Formula | C9H9F7N2O2 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C1NCCCC1(NC(=O)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C9H9F7N2O2/c10-4(11)7(2-1-3-17-5(7)19)18-6(20)8(12,13)9(14,15)16/h4H,1-3H2,(H,17,19)(H,18,20) |
| InChIKey | RPPNVDZMKKOPTO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|