C16H13NO2 — CID 53393807
6-[2-(hydroxymethyl)phenyl]-2H-isoquinolin-1-one (PubChem CID 53393807) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)phenyl]-2H-isoquinolin-1-one.
| Compound Name | 6-[2-(hydroxymethyl)phenyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 53393807 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6-[2-(hydroxymethyl)phenyl]-2H-isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(-c3ccccc3CO)ccc12 |
| InChI | InChI=1S/C16H13NO2/c18-10-13-3-1-2-4-14(13)11-5-6-15-12(9-11)7-8-17-16(15)19/h1-9,18H,10H2,(H,17,19) |
| InChIKey | UYPQNXCIONEUFC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |