C21H32O5 — CID 53394063
8-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]-2-oxooctanoic acid (PubChem CID 53394063) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 8-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]-2-oxooctanoic acid.
| Compound Name | 8-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]-2-oxooctanoic acid |
|---|---|
| PubChem CID | 53394063 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 8-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]-2-oxooctanoic acid |
| SMILES | CCCCCC(O)C=CC1C=CC(=O)C1CCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C21H32O5/c1-2-3-6-9-17(22)14-12-16-13-15-19(23)18(16)10-7-4-5-8-11-20(24)21(25)26/h12-18,22H,2-11H2,1H3,(H,25,26) |
| InChIKey | ZMSIOGLWJPSSFG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|