C18H28O6 — CID 53394243
5-[4-hydroxy-2-(3-hydroxyoct-1-enyl)-6-oxooxan-3-yl]pent-3-enoic acid (PubChem CID 53394243) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-[4-hydroxy-2-(3-hydroxyoct-1-enyl)-6-oxooxan-3-yl]pent-3-enoic acid.
| Compound Name | 5-[4-hydroxy-2-(3-hydroxyoct-1-enyl)-6-oxooxan-3-yl]pent-3-enoic acid |
|---|---|
| PubChem CID | 53394243 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 5-[4-hydroxy-2-(3-hydroxyoct-1-enyl)-6-oxooxan-3-yl]pent-3-enoic acid |
| SMILES | CCCCCC(O)C=CC1OC(=O)CC(O)C1CC=CCC(=O)O |
| InChI | InChI=1S/C18H28O6/c1-2-3-4-7-13(19)10-11-16-14(8-5-6-9-17(21)22)15(20)12-18(23)24-16/h5-6,10-11,13-16,19-20H,2-4,7-9,12H2,1H3,(H,21,22) |
| InChIKey | PJAAKFHMQLYVGV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|