C23H40O3 — CID 53394295
2-icosa-5,8,11,14-tetraenoxypropane-1,3-diol (PubChem CID 53394295) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-icosa-5,8,11,14-tetraenoxypropane-1,3-diol.
| Compound Name | 2-icosa-5,8,11,14-tetraenoxypropane-1,3-diol |
|---|---|
| PubChem CID | 53394295 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 2-icosa-5,8,11,14-tetraenoxypropane-1,3-diol |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCOC(CO)CO |
| InChI | InChI=1S/C23H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26-23(21-24)22-25/h6-7,9-10,12-13,15-16,23-25H,2-5,8,11,14,17-22H2,1H3 |
| InChIKey | CUJUUWXZAQHCNC-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|