C27H39NO2 — CID 53394508
N-(4-hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide (PubChem CID 53394508) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide.
| Compound Name | N-(4-hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 53394508 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | N-(4-hydroxy-2-methylphenyl)icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)Nc1ccc(O)cc1C |
| InChI | InChI=1S/C27H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27(30)28-26-22-21-25(29)23-24(26)2/h7-8,10-11,13-14,16-17,21-23,29H,3-6,9,12,15,18-20H2,1-2H3,(H,28,30) |
| InChIKey | WUZWFRWVRHLXHZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|