10-nitrooctadec-9-enoic acid

C18H33NO4 — CID 53394576

IUPAC10-nitrooctadec-9-enoic acid
SMILESCCCCCCCCC(=CCCCCCCCC(=O)O)[N+](=O)[O-]
InChIInChI=1S/C18H33NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h15H,2-14,16H2,1H3,(H,20,21)
InChIKeyWRADPCFZZWXOTI-UHFFFAOYSA-N
MW327.47 g/mol
LogP5.71
Rot. Bonds16

About 10-nitrooctadec-9-enoic acid

10-nitrooctadec-9-enoic acid (PubChem CID 53394576) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is 10-nitrooctadec-9-enoic acid.

Molecular Properties

Compound Name10-nitrooctadec-9-enoic acid
PubChem CID53394576
Molecular FormulaC18H33NO4
Molecular Weight327.47 g/mol
Exact Mass327.24
IUPAC Name10-nitrooctadec-9-enoic acid
SMILESCCCCCCCCC(=CCCCCCCCC(=O)O)[N+](=O)[O-]
InChIInChI=1S/C18H33NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h15H,2-14,16H2,1H3,(H,20,21)
InChIKeyWRADPCFZZWXOTI-UHFFFAOYSA-N
XLogP5.71
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds16
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500327.47
LogP ≤ 55.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 10-nitrooctadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-nitrooctadec-9-enoic acid?
The IUPAC name of 10-nitrooctadec-9-enoic acid (CID 53394576) is 10-nitrooctadec-9-enoic acid.
What is the SMILES notation for 10-nitrooctadec-9-enoic acid?
The canonical SMILES for 10-nitrooctadec-9-enoic acid is CCCCCCCCC(=CCCCCCCCC(=O)O)[N+](=O)[O-].
What is the InChIKey of 10-nitrooctadec-9-enoic acid?
The InChIKey is WRADPCFZZWXOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO4/c1-2-3-4-5-8-11-14-17(19(22)23)15-12-9-6-7-10-13-16-18(20)21/h15H,2-14,16H2,1H3,(H,20,21).
What are the key properties of 10-nitrooctadec-9-enoic acid?
10-nitrooctadec-9-enoic acid has a molecular weight of 327.47 g/mol, XLogP of 5.71, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitrooctadec-9-enoic acid is sourced from PubChem (CID 53394576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).