C6F14S2 — CID 53395388
pentafluoro-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]-λ6-sulfane (PubChem CID 53395388) has the molecular formula C6F14S2 and a molecular weight of 402.17 g/mol. Its IUPAC name is pentafluoro-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 53395388 |
| Molecular Formula | C6F14S2 |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 401.92 |
| IUPAC Name | pentafluoro-[2,3,5,6-tetrafluoro-4-(pentafluoro-λ6-sulfanyl)phenyl]-λ6-sulfane |
| SMILES | Fc1c(F)c(S(F)(F)(F)(F)F)c(F)c(F)c1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C6F14S2/c7-1-2(8)6(22(16,17,18,19)20)4(10)3(9)5(1)21(11,12,13,14)15 |
| InChIKey | ZGJYJNYANHLEHS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|