About N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide
N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide (PubChem CID 5339599) has the molecular formula C24H23N3O2
and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide |
| PubChem CID | 5339599 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide |
| SMILES | C/C(=N\NC(=O)CNC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-18(19-11-5-2-6-12-19)26-27-22(28)17-25-24(29)23(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,23H,17H2,1H3,(H,25,29)(H,27,28)/b26-18+ |
| InChIKey | TYKIMQVEOSKNRK-NLRVBDNBSA-N |
| XLogP | 3.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide?
The IUPAC name of N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide (CID 5339599) is N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide is C/C(=N\NC(=O)CNC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide?
The InChIKey is TYKIMQVEOSKNRK-NLRVBDNBSA-N. The full InChI is InChI=1S/C24H23N3O2/c1-18(19-11-5-2-6-12-19)26-27-22(28)17-25-24(29)23(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,23H,17H2,1H3,(H,25,29)(H,27,28)/b26-18+.
What are the key properties of N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide?
N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide has a molecular weight of 385.47 g/mol, XLogP of 3.48, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-2-[(2E)-2-(1-phenylethylidene)hydrazinyl]ethyl]-2,2-diphenylacetamide is sourced from PubChem (CID 5339599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).