About ethyl 6-chlorohex-2-enoate
ethyl 6-chlorohex-2-enoate (PubChem CID 53396035) has the molecular formula C8H13ClO2
and a molecular weight of 176.64 g/mol. Its IUPAC name is ethyl 6-chlorohex-2-enoate.
Molecular Properties
| Compound Name | ethyl 6-chlorohex-2-enoate |
| PubChem CID | 53396035 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.64 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | ethyl 6-chlorohex-2-enoate |
| SMILES | CCOC(=O)C=CCCCCl |
| InChI | InChI=1S/C8H13ClO2/c1-2-11-8(10)6-4-3-5-7-9/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | CKAKSKNWORUGDA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.64 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-chlorohex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-chlorohex-2-enoate?
The IUPAC name of ethyl 6-chlorohex-2-enoate (CID 53396035) is ethyl 6-chlorohex-2-enoate.
What is the SMILES notation for ethyl 6-chlorohex-2-enoate?
The canonical SMILES for ethyl 6-chlorohex-2-enoate is CCOC(=O)C=CCCCCl.
What is the InChIKey of ethyl 6-chlorohex-2-enoate?
The InChIKey is CKAKSKNWORUGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClO2/c1-2-11-8(10)6-4-3-5-7-9/h4,6H,2-3,5,7H2,1H3.
What are the key properties of ethyl 6-chlorohex-2-enoate?
ethyl 6-chlorohex-2-enoate has a molecular weight of 176.64 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-chlorohex-2-enoate is sourced from PubChem (CID 53396035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).