About 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride
6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride (PubChem CID 53396426) has the molecular formula C11H19Cl2N3O
and a molecular weight of 280.20 g/mol. Its IUPAC name is 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride |
| PubChem CID | 53396426 |
| Molecular Formula | C11H19Cl2N3O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride |
| SMILES | CC1CN(c2ccc(N)cn2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C11H17N3O.2ClH/c1-8-6-14(7-9(2)15-8)11-4-3-10(12)5-13-11;;/h3-5,8-9H,6-7,12H2,1-2H3;2*1H |
| InChIKey | MGTAMNDBJSINTP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride?
The IUPAC name of 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride (CID 53396426) is 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride.
What is the SMILES notation for 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride?
The canonical SMILES for 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride is CC1CN(c2ccc(N)cn2)CC(C)O1.Cl.Cl.
What is the InChIKey of 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride?
The InChIKey is MGTAMNDBJSINTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O.2ClH/c1-8-6-14(7-9(2)15-8)11-4-3-10(12)5-13-11;;/h3-5,8-9H,6-7,12H2,1-2H3;2*1H.
What are the key properties of 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride?
6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride has a molecular weight of 280.20 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dimethylmorpholin-4-yl)pyridin-3-amine;dihydrochloride is sourced from PubChem (CID 53396426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).