About ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate
ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate (PubChem CID 53397219) has the molecular formula C10H16N2O2S
and a molecular weight of 228.32 g/mol. Its IUPAC name is ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate |
| PubChem CID | 53397219 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate |
| SMILES | CCOC(=O)CCNCc1cnc(C)s1 |
| InChI | InChI=1S/C10H16N2O2S/c1-3-14-10(13)4-5-11-6-9-7-12-8(2)15-9/h7,11H,3-6H2,1-2H3 |
| InChIKey | SKZQFLHXKZRZRT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate?
The IUPAC name of ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate (CID 53397219) is ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate.
What is the SMILES notation for ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate?
The canonical SMILES for ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate is CCOC(=O)CCNCc1cnc(C)s1.
What is the InChIKey of ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate?
The InChIKey is SKZQFLHXKZRZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S/c1-3-14-10(13)4-5-11-6-9-7-12-8(2)15-9/h7,11H,3-6H2,1-2H3.
What are the key properties of ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate?
ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate has a molecular weight of 228.32 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(2-methyl-1,3-thiazol-5-yl)methylamino]propanoate is sourced from PubChem (CID 53397219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).