C8H12ClNO2S — CID 53397987
3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride (PubChem CID 53397987) has the molecular formula C8H12ClNO2S and a molecular weight of 221.71 g/mol. Its IUPAC name is 3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride.
| Compound Name | 3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 53397987 |
| Molecular Formula | C8H12ClNO2S |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 3-amino-4-thiophen-3-ylbutanoic acid;hydrochloride |
| SMILES | Cl.NC(CC(=O)O)Cc1ccsc1 |
| InChI | InChI=1S/C8H11NO2S.ClH/c9-7(4-8(10)11)3-6-1-2-12-5-6;/h1-2,5,7H,3-4,9H2,(H,10,11);1H |
| InChIKey | QDZZLMYYGBIDFT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |