C12H13F2NO2 — CID 53398259
4-[(3,4-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 53398259) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 4-[(3,4-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 53398259 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(Cc2ccc(F)c(F)c2)CN1 |
| InChI | InChI=1S/C12H13F2NO2/c13-9-2-1-7(4-10(9)14)3-8-5-11(12(16)17)15-6-8/h1-2,4,8,11,15H,3,5-6H2,(H,16,17) |
| InChIKey | BTEOPQVSZPLYIX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |