C10H14BBrN2O2 — CID 53398566
2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine (PubChem CID 53398566) has the molecular formula C10H14BBrN2O2 and a molecular weight of 284.95 g/mol. Its IUPAC name is 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine.
| Compound Name | 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
|---|---|
| PubChem CID | 53398566 |
| Molecular Formula | C10H14BBrN2O2 |
| Molecular Weight | 284.95 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine |
| SMILES | CC1(C)OB(c2cnc(Br)cn2)OC1(C)C |
| InChI | InChI=1S/C10H14BBrN2O2/c1-9(2)10(3,4)16-11(15-9)7-5-14-8(12)6-13-7/h5-6H,1-4H3 |
| InChIKey | KKXOTPRDMLYWLI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.95 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|