About [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid
[2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid (PubChem CID 53398588) has the molecular formula C9H15BN2O2S
and a molecular weight of 226.11 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid.
Molecular Properties
| Compound Name | [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid |
| PubChem CID | 53398588 |
| Molecular Formula | C9H15BN2O2S |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid |
| SMILES | CC1CCCN(c2nc(B(O)O)cs2)C1 |
| InChI | InChI=1S/C9H15BN2O2S/c1-7-3-2-4-12(5-7)9-11-8(6-15-9)10(13)14/h6-7,13-14H,2-5H2,1H3 |
| InChIKey | DIIUKFDPKPMRCW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid?
The IUPAC name of [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid (CID 53398588) is [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid.
What is the SMILES notation for [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid?
The canonical SMILES for [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid is CC1CCCN(c2nc(B(O)O)cs2)C1.
What is the InChIKey of [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid?
The InChIKey is DIIUKFDPKPMRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BN2O2S/c1-7-3-2-4-12(5-7)9-11-8(6-15-9)10(13)14/h6-7,13-14H,2-5H2,1H3.
What are the key properties of [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid?
[2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid has a molecular weight of 226.11 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-methylpiperidin-1-yl)-1,3-thiazol-4-yl]boronic acid is sourced from PubChem (CID 53398588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).