About N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 5339871) has the molecular formula C14H9Cl2N3S
and a molecular weight of 322.22 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| PubChem CID | 5339871 |
| Molecular Formula | C14H9Cl2N3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(/C=N/Nc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3S/c15-10-6-5-9(11(16)7-10)8-17-19-14-18-12-3-1-2-4-13(12)20-14/h1-8H,(H,18,19)/b17-8+ |
| InChIKey | YUPRYQYVCWVVLK-CAOOACKPSA-N |
| XLogP | 5.05 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine?
The IUPAC name of N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine (CID 5339871) is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine is Clc1ccc(/C=N/Nc2nc3ccccc3s2)c(Cl)c1.
What is the InChIKey of N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine?
The InChIKey is YUPRYQYVCWVVLK-CAOOACKPSA-N. The full InChI is InChI=1S/C14H9Cl2N3S/c15-10-6-5-9(11(16)7-10)8-17-19-14-18-12-3-1-2-4-13(12)20-14/h1-8H,(H,18,19)/b17-8+.
What are the key properties of N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine?
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine has a molecular weight of 322.22 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(2,4-dichlorophenyl)methylideneamino]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 5339871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).