About 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate
3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate (PubChem CID 53398835) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate.
Molecular Properties
| Compound Name | 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate |
| PubChem CID | 53398835 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate |
| SMILES | O.O=C(O)CCc1cn2ccccc2n1 |
| InChI | InChI=1S/C10H10N2O2.H2O/c13-10(14)5-4-8-7-12-6-2-1-3-9(12)11-8;/h1-3,6-7H,4-5H2,(H,13,14);1H2 |
| InChIKey | CFNCZIVEDRDMGF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate?
The IUPAC name of 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate (CID 53398835) is 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate.
What is the SMILES notation for 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate?
The canonical SMILES for 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate is O.O=C(O)CCc1cn2ccccc2n1.
What is the InChIKey of 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate?
The InChIKey is CFNCZIVEDRDMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.H2O/c13-10(14)5-4-8-7-12-6-2-1-3-9(12)11-8;/h1-3,6-7H,4-5H2,(H,13,14);1H2.
What are the key properties of 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate?
3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate has a molecular weight of 208.22 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazo[1,2-a]pyridin-2-ylpropanoic acid;hydrate is sourced from PubChem (CID 53398835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).