About 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride
3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 53398872) has the molecular formula C6H13ClN2O2
and a molecular weight of 180.63 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride |
| PubChem CID | 53398872 |
| Molecular Formula | C6H13ClN2O2 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | Cl.NCCN1CCCOC1=O |
| InChI | InChI=1S/C6H12N2O2.ClH/c7-2-4-8-3-1-5-10-6(8)9;/h1-5,7H2;1H |
| InChIKey | HTYWXTQWTBFBLB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride?
The IUPAC name of 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride (CID 53398872) is 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride.
What is the SMILES notation for 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride?
The canonical SMILES for 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride is Cl.NCCN1CCCOC1=O.
What is the InChIKey of 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride?
The InChIKey is HTYWXTQWTBFBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.ClH/c7-2-4-8-3-1-5-10-6(8)9;/h1-5,7H2;1H.
What are the key properties of 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride?
3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride has a molecular weight of 180.63 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)-1,3-oxazinan-2-one;hydrochloride is sourced from PubChem (CID 53398872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).