C21H28ClN7 — CID 5339984
N-[(E)-(4-chlorophenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 5339984) has the molecular formula C21H28ClN7 and a molecular weight of 413.96 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 5339984 |
| Molecular Formula | C21H28ClN7 |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-N-methyl-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CN(/N=C/c1ccc(Cl)cc1)c1nc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C21H28ClN7/c1-27(23-16-17-8-10-18(22)11-9-17)19-24-20(28-12-4-2-5-13-28)26-21(25-19)29-14-6-3-7-15-29/h8-11,16H,2-7,12-15H2,1H3/b23-16+ |
| InChIKey | KEUYXBDCTCRDOW-XQNSMLJCSA-N |
| XLogP | 3.98 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|