C14H16N4O4 — CID 53400044
3-amino-5-ethoxycarbonyl-1-[2-(4-methylphenyl)-2-oxoethyl]triazol-1-ium-4-olate (PubChem CID 53400044) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3-amino-5-ethoxycarbonyl-1-[2-(4-methylphenyl)-2-oxoethyl]triazol-1-ium-4-olate.
| Compound Name | 3-amino-5-ethoxycarbonyl-1-[2-(4-methylphenyl)-2-oxoethyl]triazol-1-ium-4-olate |
|---|---|
| PubChem CID | 53400044 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-amino-5-ethoxycarbonyl-1-[2-(4-methylphenyl)-2-oxoethyl]triazol-1-ium-4-olate |
| SMILES | CCOC(=O)c1c([O-])n(N)n[n+]1CC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16N4O4/c1-3-22-14(21)12-13(20)18(15)16-17(12)8-11(19)10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3,(H2-,15,16,20,21) |
| InChIKey | YGAPLBIEOGWPFZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|