About 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine
1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine (PubChem CID 53400251) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine |
| PubChem CID | 53400251 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine |
| SMILES | Nc1ccn(C2=CCCC=C2)n1 |
| InChI | InChI=1S/C9H11N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h2,4-7H,1,3H2,(H2,10,11) |
| InChIKey | CKSVVTYFYLYBJN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine?
The IUPAC name of 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine (CID 53400251) is 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine is Nc1ccn(C2=CCCC=C2)n1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine?
The InChIKey is CKSVVTYFYLYBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-9-6-7-12(11-9)8-4-2-1-3-5-8/h2,4-7H,1,3H2,(H2,10,11).
What are the key properties of 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine?
1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine has a molecular weight of 161.21 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-ylpyrazol-3-amine is sourced from PubChem (CID 53400251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).