About N-imino-N'-(N-phenylanilino)benzenecarboximidamide
N-imino-N'-(N-phenylanilino)benzenecarboximidamide (PubChem CID 53400513) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is N-imino-N'-(N-phenylanilino)benzenecarboximidamide.
Molecular Properties
| Compound Name | N-imino-N'-(N-phenylanilino)benzenecarboximidamide |
| PubChem CID | 53400513 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-imino-N'-(N-phenylanilino)benzenecarboximidamide |
| SMILES | [H]/N=N/C(=NN(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N4/c20-21-19(16-10-4-1-5-11-16)22-23(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,20H/b21-20+,22-19? |
| InChIKey | IUJAKVDAVKXDQV-JMQTWNPZSA-N |
| XLogP | 5.22 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-imino-N'-(N-phenylanilino)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-imino-N'-(N-phenylanilino)benzenecarboximidamide?
The IUPAC name of N-imino-N'-(N-phenylanilino)benzenecarboximidamide (CID 53400513) is N-imino-N'-(N-phenylanilino)benzenecarboximidamide.
What is the SMILES notation for N-imino-N'-(N-phenylanilino)benzenecarboximidamide?
The canonical SMILES for N-imino-N'-(N-phenylanilino)benzenecarboximidamide is [H]/N=N/C(=NN(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-imino-N'-(N-phenylanilino)benzenecarboximidamide?
The InChIKey is IUJAKVDAVKXDQV-JMQTWNPZSA-N. The full InChI is InChI=1S/C19H16N4/c20-21-19(16-10-4-1-5-11-16)22-23(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,20H/b21-20+,22-19?.
What are the key properties of N-imino-N'-(N-phenylanilino)benzenecarboximidamide?
N-imino-N'-(N-phenylanilino)benzenecarboximidamide has a molecular weight of 300.37 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-imino-N'-(N-phenylanilino)benzenecarboximidamide is sourced from PubChem (CID 53400513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).