C17H26BNO4 — CID 53400604
tert-butyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid (PubChem CID 53400604) has the molecular formula C17H26BNO4 and a molecular weight of 319.21 g/mol. Its IUPAC name is tert-butyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid.
| Compound Name | tert-butyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 53400604 |
| Molecular Formula | C17H26BNO4 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C17H26BNO4/c1-15(2,3)19(14(20)21)13-10-8-9-12(11-13)18-22-16(4,5)17(6,7)23-18/h8-11H,1-7H3,(H,20,21) |
| InChIKey | OETSKBLJEWUECD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|