About (3,4,5-triiodophenyl)methanol
(3,4,5-triiodophenyl)methanol (PubChem CID 53401071) has the molecular formula C7H5I3O
and a molecular weight of 485.83 g/mol. Its IUPAC name is (3,4,5-triiodophenyl)methanol.
Molecular Properties
| Compound Name | (3,4,5-triiodophenyl)methanol |
| PubChem CID | 53401071 |
| Molecular Formula | C7H5I3O |
| Molecular Weight | 485.83 g/mol |
| Exact Mass | 485.75 |
| IUPAC Name | (3,4,5-triiodophenyl)methanol |
| SMILES | OCc1cc(I)c(I)c(I)c1 |
| InChI | InChI=1S/C7H5I3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2 |
| InChIKey | ZEMRYPUNHUWEPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-triiodophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-triiodophenyl)methanol?
The IUPAC name of (3,4,5-triiodophenyl)methanol (CID 53401071) is (3,4,5-triiodophenyl)methanol.
What is the SMILES notation for (3,4,5-triiodophenyl)methanol?
The canonical SMILES for (3,4,5-triiodophenyl)methanol is OCc1cc(I)c(I)c(I)c1.
What is the InChIKey of (3,4,5-triiodophenyl)methanol?
The InChIKey is ZEMRYPUNHUWEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5I3O/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2,11H,3H2.
What are the key properties of (3,4,5-triiodophenyl)methanol?
(3,4,5-triiodophenyl)methanol has a molecular weight of 485.83 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-triiodophenyl)methanol is sourced from PubChem (CID 53401071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).