About 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate
1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate (PubChem CID 53401926) has the molecular formula C11H17F2NO4
and a molecular weight of 265.26 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate |
| PubChem CID | 53401926 |
| Molecular Formula | C11H17F2NO4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1CC(F)(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(16)14-6-11(12,13)5-7(14)8(15)17-4/h7H,5-6H2,1-4H3 |
| InChIKey | RQDZKOOUQIDZOG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate (CID 53401926) is 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate is COC(=O)C1CC(F)(F)CN1C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
The InChIKey is RQDZKOOUQIDZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(16)14-6-11(12,13)5-7(14)8(15)17-4/h7H,5-6H2,1-4H3.
What are the key properties of 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate?
1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate has a molecular weight of 265.26 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 53401926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).