About 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine
3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine (PubChem CID 53402074) has the molecular formula C7H5ClN4S
and a molecular weight of 212.67 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 53402074 |
| Molecular Formula | C7H5ClN4S |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(-c2ccnc(Cl)c2)ns1 |
| InChI | InChI=1S/C7H5ClN4S/c8-5-3-4(1-2-10-5)6-11-7(9)13-12-6/h1-3H,(H2,9,11,12) |
| InChIKey | CYBJRYIFCYZLSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine (CID 53402074) is 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine is Nc1nc(-c2ccnc(Cl)c2)ns1.
What is the InChIKey of 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is CYBJRYIFCYZLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4S/c8-5-3-4(1-2-10-5)6-11-7(9)13-12-6/h1-3H,(H2,9,11,12).
What are the key properties of 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine?
3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 212.67 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4-pyridinyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 53402074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).