C10H7F2N — CID 53402677
1-(3,5-difluorophenyl)cyclopropane-1-carbonitrile (PubChem CID 53402677) has the molecular formula C10H7F2N and a molecular weight of 179.17 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)cyclopropane-1-carbonitrile.
| Compound Name | 1-(3,5-difluorophenyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 53402677 |
| Molecular Formula | C10H7F2N |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-(3,5-difluorophenyl)cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C10H7F2N/c11-8-3-7(4-9(12)5-8)10(6-13)1-2-10/h3-5H,1-2H2 |
| InChIKey | WHYHFQTUOOGNDA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |