About 1-ethylimidazol-4-amine
1-ethylimidazol-4-amine (PubChem CID 53403306) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 1-ethylimidazol-4-amine.
Molecular Properties
| Compound Name | 1-ethylimidazol-4-amine |
| PubChem CID | 53403306 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 1-ethylimidazol-4-amine |
| SMILES | CCn1cnc(N)c1 |
| InChI | InChI=1S/C5H9N3/c1-2-8-3-5(6)7-4-8/h3-4H,2,6H2,1H3 |
| InChIKey | DPRMXZQCCDEZAL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylimidazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylimidazol-4-amine?
The IUPAC name of 1-ethylimidazol-4-amine (CID 53403306) is 1-ethylimidazol-4-amine.
What is the SMILES notation for 1-ethylimidazol-4-amine?
The canonical SMILES for 1-ethylimidazol-4-amine is CCn1cnc(N)c1.
What is the InChIKey of 1-ethylimidazol-4-amine?
The InChIKey is DPRMXZQCCDEZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c1-2-8-3-5(6)7-4-8/h3-4H,2,6H2,1H3.
What are the key properties of 1-ethylimidazol-4-amine?
1-ethylimidazol-4-amine has a molecular weight of 111.15 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylimidazol-4-amine is sourced from PubChem (CID 53403306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).