C8H5F3O — CID 53403555
2-(3,4,5-trifluorophenyl)acetaldehyde (PubChem CID 53403555) has the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. Its IUPAC name is 2-(3,4,5-trifluorophenyl)acetaldehyde.
| Compound Name | 2-(3,4,5-trifluorophenyl)acetaldehyde |
|---|---|
| PubChem CID | 53403555 |
| Molecular Formula | C8H5F3O |
| Molecular Weight | 174.12 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 2-(3,4,5-trifluorophenyl)acetaldehyde |
| SMILES | O=CCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C8H5F3O/c9-6-3-5(1-2-12)4-7(10)8(6)11/h2-4H,1H2 |
| InChIKey | UWOQYJMJCAPGOD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.12 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|