About 3-(2,3,4-trifluorophenyl)propan-1-ol
3-(2,3,4-trifluorophenyl)propan-1-ol (PubChem CID 53403866) has the molecular formula C9H9F3O
and a molecular weight of 190.16 g/mol. Its IUPAC name is 3-(2,3,4-trifluorophenyl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,3,4-trifluorophenyl)propan-1-ol |
| PubChem CID | 53403866 |
| Molecular Formula | C9H9F3O |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-(2,3,4-trifluorophenyl)propan-1-ol |
| SMILES | OCCCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H9F3O/c10-7-4-3-6(2-1-5-13)8(11)9(7)12/h3-4,13H,1-2,5H2 |
| InChIKey | QRWOSXAVHYZSTQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,4-trifluorophenyl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,4-trifluorophenyl)propan-1-ol?
The IUPAC name of 3-(2,3,4-trifluorophenyl)propan-1-ol (CID 53403866) is 3-(2,3,4-trifluorophenyl)propan-1-ol.
What is the SMILES notation for 3-(2,3,4-trifluorophenyl)propan-1-ol?
The canonical SMILES for 3-(2,3,4-trifluorophenyl)propan-1-ol is OCCCc1ccc(F)c(F)c1F.
What is the InChIKey of 3-(2,3,4-trifluorophenyl)propan-1-ol?
The InChIKey is QRWOSXAVHYZSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3O/c10-7-4-3-6(2-1-5-13)8(11)9(7)12/h3-4,13H,1-2,5H2.
What are the key properties of 3-(2,3,4-trifluorophenyl)propan-1-ol?
3-(2,3,4-trifluorophenyl)propan-1-ol has a molecular weight of 190.16 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,4-trifluorophenyl)propan-1-ol is sourced from PubChem (CID 53403866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).