C14H16F8N2O2 — CID 5340400
(Z)-1,1,2,2-tetrafluoro-5-[2-[[(Z)-5,5,6,6-tetrafluoro-4-oxohex-2-en-2-yl]amino]ethylamino]hex-4-en-3-one (PubChem CID 5340400) has the molecular formula C14H16F8N2O2 and a molecular weight of 396.28 g/mol. Its IUPAC name is (Z)-1,1,2,2-tetrafluoro-5-[2-[[(Z)-5,5,6,6-tetrafluoro-4-oxohex-2-en-2-yl]amino]ethylamino]hex-4-en-3-one.
| Compound Name | (Z)-1,1,2,2-tetrafluoro-5-[2-[[(Z)-5,5,6,6-tetrafluoro-4-oxohex-2-en-2-yl]amino]ethylamino]hex-4-en-3-one |
|---|---|
| PubChem CID | 5340400 |
| Molecular Formula | C14H16F8N2O2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (Z)-1,1,2,2-tetrafluoro-5-[2-[[(Z)-5,5,6,6-tetrafluoro-4-oxohex-2-en-2-yl]amino]ethylamino]hex-4-en-3-one |
| SMILES | C/C(=C/C(=O)C(F)(F)C(F)F)NCCN/C(C)=C\C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H16F8N2O2/c1-7(5-9(25)13(19,20)11(15)16)23-3-4-24-8(2)6-10(26)14(21,22)12(17)18/h5-6,11-12,23-24H,3-4H2,1-2H3/b7-5-,8-6- |
| InChIKey | XQSWIOCHXKZXSH-SFECMWDFSA-N |
| XLogP | 2.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|