About 4-cyano-2-iodobenzoic acid
4-cyano-2-iodobenzoic acid (PubChem CID 53404296) has the molecular formula C8H4INO2
and a molecular weight of 273.03 g/mol. Its IUPAC name is 4-cyano-2-iodobenzoic acid.
Molecular Properties
| Compound Name | 4-cyano-2-iodobenzoic acid |
| PubChem CID | 53404296 |
| Molecular Formula | C8H4INO2 |
| Molecular Weight | 273.03 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 4-cyano-2-iodobenzoic acid |
| SMILES | N#Cc1ccc(C(=O)O)c(I)c1 |
| InChI | InChI=1S/C8H4INO2/c9-7-3-5(4-10)1-2-6(7)8(11)12/h1-3H,(H,11,12) |
| InChIKey | OWTQANSUZFJZRT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.03 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-2-iodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2-iodobenzoic acid?
The IUPAC name of 4-cyano-2-iodobenzoic acid (CID 53404296) is 4-cyano-2-iodobenzoic acid.
What is the SMILES notation for 4-cyano-2-iodobenzoic acid?
The canonical SMILES for 4-cyano-2-iodobenzoic acid is N#Cc1ccc(C(=O)O)c(I)c1.
What is the InChIKey of 4-cyano-2-iodobenzoic acid?
The InChIKey is OWTQANSUZFJZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4INO2/c9-7-3-5(4-10)1-2-6(7)8(11)12/h1-3H,(H,11,12).
What are the key properties of 4-cyano-2-iodobenzoic acid?
4-cyano-2-iodobenzoic acid has a molecular weight of 273.03 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2-iodobenzoic acid is sourced from PubChem (CID 53404296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).