C11H9BrN2O2S — CID 53404615
ethyl 3-(4-bromophenyl)-1,2,4-thiadiazole-5-carboxylate (PubChem CID 53404615) has the molecular formula C11H9BrN2O2S and a molecular weight of 313.18 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-1,2,4-thiadiazole-5-carboxylate.
| Compound Name | ethyl 3-(4-bromophenyl)-1,2,4-thiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 53404615 |
| Molecular Formula | C11H9BrN2O2S |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-1,2,4-thiadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(Br)cc2)ns1 |
| InChI | InChI=1S/C11H9BrN2O2S/c1-2-16-11(15)10-13-9(14-17-10)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | VBUCLRYGPZBESV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |