About 6-ethyl-1,2,4-triazine-3-carboxylic acid
6-ethyl-1,2,4-triazine-3-carboxylic acid (PubChem CID 53404915) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 6-ethyl-1,2,4-triazine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethyl-1,2,4-triazine-3-carboxylic acid |
| PubChem CID | 53404915 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 6-ethyl-1,2,4-triazine-3-carboxylic acid |
| SMILES | CCc1cnc(C(=O)O)nn1 |
| InChI | InChI=1S/C6H7N3O2/c1-2-4-3-7-5(6(10)11)9-8-4/h3H,2H2,1H3,(H,10,11) |
| InChIKey | DODHZGORRQEZLG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-1,2,4-triazine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,2,4-triazine-3-carboxylic acid?
The IUPAC name of 6-ethyl-1,2,4-triazine-3-carboxylic acid (CID 53404915) is 6-ethyl-1,2,4-triazine-3-carboxylic acid.
What is the SMILES notation for 6-ethyl-1,2,4-triazine-3-carboxylic acid?
The canonical SMILES for 6-ethyl-1,2,4-triazine-3-carboxylic acid is CCc1cnc(C(=O)O)nn1.
What is the InChIKey of 6-ethyl-1,2,4-triazine-3-carboxylic acid?
The InChIKey is DODHZGORRQEZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c1-2-4-3-7-5(6(10)11)9-8-4/h3H,2H2,1H3,(H,10,11).
What are the key properties of 6-ethyl-1,2,4-triazine-3-carboxylic acid?
6-ethyl-1,2,4-triazine-3-carboxylic acid has a molecular weight of 153.14 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,2,4-triazine-3-carboxylic acid is sourced from PubChem (CID 53404915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).