About hepta-4,6-dienoic acid
hepta-4,6-dienoic acid (PubChem CID 53405102) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is hepta-4,6-dienoic acid.
Molecular Properties
| Compound Name | hepta-4,6-dienoic acid |
| PubChem CID | 53405102 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | hepta-4,6-dienoic acid |
| SMILES | C=CC=CCCC(=O)O |
| InChI | InChI=1S/C7H10O2/c1-2-3-4-5-6-7(8)9/h2-4H,1,5-6H2,(H,8,9) |
| InChIKey | HHLIJJJAKAFXJB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hepta-4,6-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-4,6-dienoic acid?
The IUPAC name of hepta-4,6-dienoic acid (CID 53405102) is hepta-4,6-dienoic acid.
What is the SMILES notation for hepta-4,6-dienoic acid?
The canonical SMILES for hepta-4,6-dienoic acid is C=CC=CCCC(=O)O.
What is the InChIKey of hepta-4,6-dienoic acid?
The InChIKey is HHLIJJJAKAFXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-2-3-4-5-6-7(8)9/h2-4H,1,5-6H2,(H,8,9).
What are the key properties of hepta-4,6-dienoic acid?
hepta-4,6-dienoic acid has a molecular weight of 126.15 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-4,6-dienoic acid is sourced from PubChem (CID 53405102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).