About 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide
10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide (PubChem CID 5340523) has the molecular formula C14H20BrN3
and a molecular weight of 310.24 g/mol. Its IUPAC name is 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide.
Molecular Properties
| Compound Name | 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide |
| PubChem CID | 5340523 |
| Molecular Formula | C14H20BrN3 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide |
| SMILES | Br.CCCCN1C2=NCCCN2c2ccccc21 |
| InChI | InChI=1S/C14H19N3.BrH/c1-2-3-10-16-12-7-4-5-8-13(12)17-11-6-9-15-14(16)17;/h4-5,7-8H,2-3,6,9-11H2,1H3;1H |
| InChIKey | FOFZNVXVRKDEAL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide?
The IUPAC name of 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide (CID 5340523) is 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide.
What is the SMILES notation for 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide?
The canonical SMILES for 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide is Br.CCCCN1C2=NCCCN2c2ccccc21.
What is the InChIKey of 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide?
The InChIKey is FOFZNVXVRKDEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3.BrH/c1-2-3-10-16-12-7-4-5-8-13(12)17-11-6-9-15-14(16)17;/h4-5,7-8H,2-3,6,9-11H2,1H3;1H.
What are the key properties of 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide?
10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide has a molecular weight of 310.24 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-butyl-3,4-dihydro-2H-pyrimido[1,2-a]benzimidazole;hydrobromide is sourced from PubChem (CID 5340523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).