About 3-methylbut-1-en-1-amine
3-methylbut-1-en-1-amine (PubChem CID 53405416) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is 3-methylbut-1-en-1-amine.
Molecular Properties
| Compound Name | 3-methylbut-1-en-1-amine |
| PubChem CID | 53405416 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | 3-methylbut-1-en-1-amine |
| SMILES | CC(C)C=CN |
| InChI | InChI=1S/C5H11N/c1-5(2)3-4-6/h3-5H,6H2,1-2H3 |
| InChIKey | NIUYHRXMNKYURX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-1-en-1-amine?
The IUPAC name of 3-methylbut-1-en-1-amine (CID 53405416) is 3-methylbut-1-en-1-amine.
What is the SMILES notation for 3-methylbut-1-en-1-amine?
The canonical SMILES for 3-methylbut-1-en-1-amine is CC(C)C=CN.
What is the InChIKey of 3-methylbut-1-en-1-amine?
The InChIKey is NIUYHRXMNKYURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-5(2)3-4-6/h3-5H,6H2,1-2H3.
What are the key properties of 3-methylbut-1-en-1-amine?
3-methylbut-1-en-1-amine has a molecular weight of 85.15 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-1-en-1-amine is sourced from PubChem (CID 53405416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).