About Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]-
Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- (PubChem CID 53405496) has the molecular formula C16H22BO3Si
and a molecular weight of 301.25 g/mol.
Molecular Properties
| Compound Name | Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- |
| PubChem CID | 53405496 |
| Molecular Formula | C16H22BO3Si |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)Oc1c(B(O)O)ccc2cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C16H22BO3Si/c1-16(2,3)12-7-8-13-11(10-12)6-9-14(17(18)19)15(13)20-21(4)5/h6-10,18-19H,1-5H3 |
| InChIKey | PPBKORVDTDHNSD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]-?
The IUPAC name of Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- (CID 53405496) is not available.
What is the SMILES notation for Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]-?
The canonical SMILES for Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- is C[Si](C)Oc1c(B(O)O)ccc2cc(C(C)(C)C)ccc12.
What is the InChIKey of Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]-?
The InChIKey is PPBKORVDTDHNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BO3Si/c1-16(2,3)12-7-8-13-11(10-12)6-9-14(17(18)19)15(13)20-21(4)5/h6-10,18-19H,1-5H3.
What are the key properties of Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]-?
Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- has a molecular weight of 301.25 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Boronic acid,B-[6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2-naphthalenyl]- is sourced from PubChem (CID 53405496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).