About 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one
3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one (PubChem CID 53406300) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one |
| PubChem CID | 53406300 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one |
| SMILES | CN1C(=O)NC2C=CC=CC21 |
| InChI | InChI=1S/C8H10N2O/c1-10-7-5-3-2-4-6(7)9-8(10)11/h2-7H,1H3,(H,9,11) |
| InChIKey | JZVBXLSQURKPHX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one?
The IUPAC name of 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one (CID 53406300) is 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one.
What is the SMILES notation for 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one?
The canonical SMILES for 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one is CN1C(=O)NC2C=CC=CC21.
What is the InChIKey of 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one?
The InChIKey is JZVBXLSQURKPHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-10-7-5-3-2-4-6(7)9-8(10)11/h2-7H,1H3,(H,9,11).
What are the key properties of 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one?
3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one has a molecular weight of 150.18 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3a,7a-dihydro-1H-benzimidazol-2-one is sourced from PubChem (CID 53406300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).