C20H20BNO4 — CID 53406477
2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 53406477) has the molecular formula C20H20BNO4 and a molecular weight of 349.20 g/mol. Its IUPAC name is 2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53406477 |
| Molecular Formula | C20H20BNO4 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)COB(c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)OC1 |
| InChI | InChI=1S/C20H20BNO4/c1-20(2)12-25-21(26-13-20)15-9-7-14(8-10-15)11-22-18(23)16-5-3-4-6-17(16)19(22)24/h3-10H,11-13H2,1-2H3 |
| InChIKey | ASUWHIZYHBPRAH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|