C8H13BN2O2 — CID 53406836
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1H-pyrazole (PubChem CID 53406836) has the molecular formula C8H13BN2O2 and a molecular weight of 180.02 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1H-pyrazole.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 53406836 |
| Molecular Formula | C8H13BN2O2 |
| Molecular Weight | 180.02 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1H-pyrazole |
| SMILES | CC1(C)COB(c2cn[nH]c2)OC1 |
| InChI | InChI=1S/C8H13BN2O2/c1-8(2)5-12-9(13-6-8)7-3-10-11-4-7/h3-4H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | UUNSPNOSBIRLHE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.02 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|